C14H9Cl3N2O2S — CID 7701319
2-thiophen-2-yl-5-[(1S)-1-(2,4,5-trichlorophenoxy)ethyl]-1,3,4-oxadiazole (PubChem CID 7701319) has the molecular formula C14H9Cl3N2O2S and a molecular weight of 375.66 g/mol. Its IUPAC name is 2-thiophen-2-yl-5-[(1S)-1-(2,4,5-trichlorophenoxy)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-thiophen-2-yl-5-[(1S)-1-(2,4,5-trichlorophenoxy)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7701319 |
| Molecular Formula | C14H9Cl3N2O2S |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2-thiophen-2-yl-5-[(1S)-1-(2,4,5-trichlorophenoxy)ethyl]-1,3,4-oxadiazole |
| SMILES | C[C@H](Oc1cc(Cl)c(Cl)cc1Cl)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C14H9Cl3N2O2S/c1-7(20-11-6-9(16)8(15)5-10(11)17)13-18-19-14(21-13)12-3-2-4-22-12/h2-7H,1H3/t7-/m0/s1 |
| InChIKey | LRKUNATVKBGWQT-ZETCQYMHSA-N |
| XLogP | 5.90 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|