C19H28N3O4S+ — CID 7163138
N-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]ethanesulfonamide (PubChem CID 7163138) has the molecular formula C19H28N3O4S+ and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]ethanesulfonamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 7163138 |
| Molecular Formula | C19H28N3O4S+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@H](c1ccco1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-3-27(23,24)20-15-18(19-5-4-14-26-19)22-12-10-21(11-13-22)16-6-8-17(25-2)9-7-16/h4-9,14,18,20H,3,10-13,15H2,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | VGXPVLWMANZVHD-GOSISDBHSA-O |
| XLogP | 0.67 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|