C23H33N4O3+ — CID 7162604
N'-[(2S)-2-(furan-2-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethyl]-N-(3-methylbutyl)oxamide (PubChem CID 7162604) has the molecular formula C23H33N4O3+ and a molecular weight of 413.54 g/mol. Its IUPAC name is N'-[(2S)-2-(furan-2-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethyl]-N-(3-methylbutyl)oxamide.
| Compound Name | N'-[(2S)-2-(furan-2-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethyl]-N-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 7162604 |
| Molecular Formula | C23H33N4O3+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N'-[(2S)-2-(furan-2-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethyl]-N-(3-methylbutyl)oxamide |
| SMILES | CC(C)CCNC(=O)C(=O)NC[C@@H](c1ccco1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-18(2)10-11-24-22(28)23(29)25-17-20(21-9-6-16-30-21)27-14-12-26(13-15-27)19-7-4-3-5-8-19/h3-9,16,18,20H,10-15,17H2,1-2H3,(H,24,28)(H,25,29)/p+1/t20-/m0/s1 |
| InChIKey | KRTQHLVIIBYGFN-FQEVSTJZSA-O |
| XLogP | 1.00 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|