C21H28FN4O3+ — CID 7162906
N'-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-(furan-2-yl)ethyl]-N-propyloxamide (PubChem CID 7162906) has the molecular formula C21H28FN4O3+ and a molecular weight of 403.48 g/mol. Its IUPAC name is N'-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-(furan-2-yl)ethyl]-N-propyloxamide.
| Compound Name | N'-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-(furan-2-yl)ethyl]-N-propyloxamide |
|---|---|
| PubChem CID | 7162906 |
| Molecular Formula | C21H28FN4O3+ |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N'-[(2S)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-(furan-2-yl)ethyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NC[C@@H](c1ccco1)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H27FN4O3/c1-2-9-23-20(27)21(28)24-15-18(19-8-5-14-29-19)26-12-10-25(11-13-26)17-7-4-3-6-16(17)22/h3-8,14,18H,2,9-13,15H2,1H3,(H,23,27)(H,24,28)/p+1/t18-/m0/s1 |
| InChIKey | GHOBYIDMCJLTIB-SFHVURJKSA-O |
| XLogP | 0.51 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|