C23H31N6O2+ — CID 7388484
1-[(R)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-phenylpiperazin-1-ium (PubChem CID 7388484) has the molecular formula C23H31N6O2+ and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[(R)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(R)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7388484 |
| Molecular Formula | C23H31N6O2+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[(R)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-phenylpiperazin-1-ium |
| SMILES | CCOc1ccc([C@H](c2nnnn2CCOC)[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N6O2/c1-3-31-21-11-9-19(10-12-21)22(23-24-25-26-29(23)17-18-30-2)28-15-13-27(14-16-28)20-7-5-4-6-8-20/h4-12,22H,3,13-18H2,1-2H3/p+1/t22-/m1/s1 |
| InChIKey | BQBBXWDRXWFQBR-JOCHJYFZSA-O |
| XLogP | 1.21 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |