C18H29N6O2+ — CID 7388089
1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]propyl]-4-(3-methoxyphenyl)piperazin-1-ium (PubChem CID 7388089) has the molecular formula C18H29N6O2+ and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]propyl]-4-(3-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]propyl]-4-(3-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7388089 |
| Molecular Formula | C18H29N6O2+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]propyl]-4-(3-methoxyphenyl)piperazin-1-ium |
| SMILES | CC[C@H](c1nnnn1CCOC)[NH+]1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C18H28N6O2/c1-4-17(18-19-20-21-24(18)12-13-25-2)23-10-8-22(9-11-23)15-6-5-7-16(14-15)26-3/h5-7,14,17H,4,8-13H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | RFYOVKOKJRXJSR-QGZVFWFLSA-O |
| XLogP | 0.18 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |