C21H30FN5 — CID 3173829
N-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-N-methylcyclohexanamine (PubChem CID 3173829) has the molecular formula C21H30FN5 and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-N-methylcyclohexanamine.
| Compound Name | N-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-N-methylcyclohexanamine |
|---|---|
| PubChem CID | 3173829 |
| Molecular Formula | C21H30FN5 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | N-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-N-methylcyclohexanamine |
| SMILES | CN(C1CCCCC1)C(c1ccc(F)cc1)c1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C21H30FN5/c1-26(18-8-4-2-5-9-18)20(16-12-14-17(22)15-13-16)21-23-24-25-27(21)19-10-6-3-7-11-19/h12-15,18-20H,2-11H2,1H3 |
| InChIKey | SOKMNHUOJCZRKE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |