C27H27N7 — CID 1437603
3-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-(4-phenylpiperazin-1-yl)methyl]benzonitrile (PubChem CID 1437603) has the molecular formula C27H27N7 and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-(4-phenylpiperazin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-(4-phenylpiperazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 1437603 |
| Molecular Formula | C27H27N7 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 3-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-(4-phenylpiperazin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc([C@H](c2nnnn2CCc2ccccc2)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H27N7/c28-21-23-10-7-11-24(20-23)26(33-18-16-32(17-19-33)25-12-5-2-6-13-25)27-29-30-31-34(27)15-14-22-8-3-1-4-9-22/h1-13,20,26H,14-19H2/t26-/m1/s1 |
| InChIKey | QTIVNSUYQITNKT-AREMUKBSSA-N |
| XLogP | 3.70 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |