C18H24ClN6O- — CID 53346857
3-[azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]benzonitrile chloride (PubChem CID 53346857) has the molecular formula C18H24ClN6O- and a molecular weight of 375.88 g/mol. Its IUPAC name is 3-[azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]benzonitrile chloride.
| Compound Name | 3-[azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]benzonitrile chloride |
|---|---|
| PubChem CID | 53346857 |
| Molecular Formula | C18H24ClN6O- |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-[azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]benzonitrile chloride |
| SMILES | COCCn1nnnc1C(c1cccc(C#N)c1)N1CCCCCC1.[Cl-] |
| InChI | InChI=1S/C18H24N6O.ClH/c1-25-12-11-24-18(20-21-22-24)17(23-9-4-2-3-5-10-23)16-8-6-7-15(13-16)14-19;/h6-8,13,17H,2-5,9-12H2,1H3;1H/p-1 |
| InChIKey | UBAWQYRQCSJCBV-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 79.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |