C24H33N7 — CID 3229204
3-[(4-cyclohexylpiperazin-1-yl)-(1-cyclopentyltetrazol-5-yl)methyl]benzonitrile (PubChem CID 3229204) has the molecular formula C24H33N7 and a molecular weight of 419.58 g/mol. Its IUPAC name is 3-[(4-cyclohexylpiperazin-1-yl)-(1-cyclopentyltetrazol-5-yl)methyl]benzonitrile.
| Compound Name | 3-[(4-cyclohexylpiperazin-1-yl)-(1-cyclopentyltetrazol-5-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 3229204 |
| Molecular Formula | C24H33N7 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 3-[(4-cyclohexylpiperazin-1-yl)-(1-cyclopentyltetrazol-5-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(C(c2nnnn2C2CCCC2)N2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H33N7/c25-18-19-7-6-8-20(17-19)23(24-26-27-28-31(24)22-11-4-5-12-22)30-15-13-29(14-16-30)21-9-2-1-3-10-21/h6-8,17,21-23H,1-5,9-16H2 |
| InChIKey | SOMKMYUPDRKRPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |