C22H34N6O2 — CID 1448734
1-[(R)-(2,3-dimethoxyphenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine (PubChem CID 1448734) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(R)-(2,3-dimethoxyphenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(R)-(2,3-dimethoxyphenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1448734 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-[(R)-(2,3-dimethoxyphenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](c2cccc(OC)c2OC)c2nnnn2CCC(C)C)CC1 |
| InChI | InChI=1S/C22H34N6O2/c1-6-11-26-13-15-27(16-14-26)20(18-8-7-9-19(29-4)21(18)30-5)22-23-24-25-28(22)12-10-17(2)3/h6-9,17,20H,1,10-16H2,2-5H3/t20-/m1/s1 |
| InChIKey | FIUMSJMULYEKPT-HXUWFJFHSA-N |
| XLogP | 2.63 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|