C24H29FN6O2 — CID 3209880
1-[(2,4-dimethoxyphenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine (PubChem CID 3209880) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 3209880 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(C(c2ccc(OC)cc2OC)c2nnnn2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29FN6O2/c1-4-11-29-12-14-30(15-13-29)23(21-10-9-20(32-2)16-22(21)33-3)24-26-27-28-31(24)17-18-5-7-19(25)8-6-18/h4-10,16,23H,1,11-15,17H2,2-3H3 |
| InChIKey | MJCHIFNBMCRVIG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|