C24H31ClN6O2 — CID 171668407
1-[(1-benzyltetrazol-5-yl)-(2,5-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride (PubChem CID 171668407) has the molecular formula C24H31ClN6O2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)-(2,5-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)-(2,5-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668407 |
| Molecular Formula | C24H31ClN6O2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)-(2,5-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
| SMILES | C=CCN1CCN(C(c2cc(OC)ccc2OC)c2nnnn2Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C24H30N6O2.ClH/c1-4-12-28-13-15-29(16-14-28)23(21-17-20(31-2)10-11-22(21)32-3)24-25-26-27-30(24)18-19-8-6-5-7-9-19;/h4-11,17,23H,1,12-16,18H2,2-3H3;1H |
| InChIKey | JOUAFARCSBATMW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|