C20H30N6 — CID 1448652
1-[(R)-[1-(3-methylbutyl)tetrazol-5-yl]-phenylmethyl]-4-prop-2-enylpiperazine (PubChem CID 1448652) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[(R)-[1-(3-methylbutyl)tetrazol-5-yl]-phenylmethyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(R)-[1-(3-methylbutyl)tetrazol-5-yl]-phenylmethyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1448652 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-[(R)-[1-(3-methylbutyl)tetrazol-5-yl]-phenylmethyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](c2ccccc2)c2nnnn2CCC(C)C)CC1 |
| InChI | InChI=1S/C20H30N6/c1-4-11-24-13-15-25(16-14-24)19(18-8-6-5-7-9-18)20-21-22-23-26(20)12-10-17(2)3/h4-9,17,19H,1,10-16H2,2-3H3/t19-/m1/s1 |
| InChIKey | LRGFCVWFGTVNTF-LJQANCHMSA-N |
| XLogP | 2.61 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|