C18H34N6 — CID 857676
1-[(1S)-3-methyl-1-[1-(3-methylbutyl)tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine (PubChem CID 857676) has the molecular formula C18H34N6 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-[1-(3-methylbutyl)tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(1S)-3-methyl-1-[1-(3-methylbutyl)tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 857676 |
| Molecular Formula | C18H34N6 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | 1-[(1S)-3-methyl-1-[1-(3-methylbutyl)tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@@H](CC(C)C)c2nnnn2CCC(C)C)CC1 |
| InChI | InChI=1S/C18H34N6/c1-6-8-22-10-12-23(13-11-22)17(14-16(4)5)18-19-20-21-24(18)9-7-15(2)3/h6,15-17H,1,7-14H2,2-5H3/t17-/m0/s1 |
| InChIKey | SARZZQHZQFIDBO-KRWDZBQOSA-N |
| XLogP | 2.61 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|