C21H32N6O2 — CID 1444099
1-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine (PubChem CID 1444099) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1444099 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@@H](c2ccc(OC)c(OC)c2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32N6O2/c1-7-10-25-11-13-26(14-12-25)19(20-22-23-24-27(20)21(2,3)4)16-8-9-17(28-5)18(15-16)29-6/h7-9,15,19H,1,10-14H2,2-6H3/t19-/m0/s1 |
| InChIKey | MDAKBFNXYMCUAP-IBGZPJMESA-N |
| XLogP | 2.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|