C19H33N7O+2 — CID 7388462
4-[(R)-(4-ethylpiperazine-1,4-diium-1-yl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline (PubChem CID 7388462) has the molecular formula C19H33N7O+2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[(R)-(4-ethylpiperazine-1,4-diium-1-yl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(R)-(4-ethylpiperazine-1,4-diium-1-yl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7388462 |
| Molecular Formula | C19H33N7O+2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 4-[(R)-(4-ethylpiperazine-1,4-diium-1-yl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline |
| SMILES | CC[NH+]1CC[NH+]([C@H](c2ccc(N(C)C)cc2)c2nnnn2CCOC)CC1 |
| InChI | InChI=1S/C19H31N7O/c1-5-24-10-12-25(13-11-24)18(16-6-8-17(9-7-16)23(2)3)19-20-21-22-26(19)14-15-27-4/h6-9,18H,5,10-15H2,1-4H3/p+2/t18-/m1/s1 |
| InChIKey | NKKFHCUCWDGHRB-GOSISDBHSA-P |
| XLogP | -1.72 |
| TPSA | 64.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|