C27H32N7O3+ — CID 6990936
2-[5-[(S)-[4-(dimethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]tetrazol-1-yl]ethyl N-naphthalen-1-ylcarbamate (PubChem CID 6990936) has the molecular formula C27H32N7O3+ and a molecular weight of 502.60 g/mol. Its IUPAC name is 2-[5-[(S)-[4-(dimethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]tetrazol-1-yl]ethyl N-naphthalen-1-ylcarbamate.
| Compound Name | 2-[5-[(S)-[4-(dimethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]tetrazol-1-yl]ethyl N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 6990936 |
| Molecular Formula | C27H32N7O3+ |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 2-[5-[(S)-[4-(dimethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]tetrazol-1-yl]ethyl N-naphthalen-1-ylcarbamate |
| SMILES | CN(C)c1ccc([C@@H](c2nnnn2CCOC(=O)Nc2cccc3ccccc23)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C27H31N7O3/c1-32(2)22-12-10-21(11-13-22)25(33-14-17-36-18-15-33)26-29-30-31-34(26)16-19-37-27(35)28-24-9-5-7-20-6-3-4-8-23(20)24/h3-13,25H,14-19H2,1-2H3,(H,28,35)/p+1/t25-/m0/s1 |
| InChIKey | AGGPFTLBCLCTQV-VWLOTQADSA-O |
| XLogP | 2.15 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|