About 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol
4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol (PubChem CID 7071990) has the molecular formula C20H24N5O2+
and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol.
Molecular Properties
| Compound Name | 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol |
| PubChem CID | 7071990 |
| Molecular Formula | C20H24N5O2+ |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol |
| SMILES | Cc1cccc(C)c1-n1nnnc1[C@@H](c1ccc(O)cc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H23N5O2/c1-14-4-3-5-15(2)18(14)25-20(21-22-23-25)19(24-10-12-27-13-11-24)16-6-8-17(26)9-7-16/h3-9,19,26H,10-13H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | LQMSXKXBGREFRS-LJQANCHMSA-O |
| XLogP | 0.99 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol?
The IUPAC name of 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol (CID 7071990) is 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol.
What is the SMILES notation for 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol?
The canonical SMILES for 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol is Cc1cccc(C)c1-n1nnnc1[C@@H](c1ccc(O)cc1)[NH+]1CCOCC1.
What is the InChIKey of 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol?
The InChIKey is LQMSXKXBGREFRS-LJQANCHMSA-O. The full InChI is InChI=1S/C20H23N5O2/c1-14-4-3-5-15(2)18(14)25-20(21-22-23-25)19(24-10-12-27-13-11-24)16-6-8-17(26)9-7-16/h3-9,19,26H,10-13H2,1-2H3/p+1/t19-/m1/s1.
What are the key properties of 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol?
4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol has a molecular weight of 366.45 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-morpholin-4-ium-4-ylmethyl]phenol is sourced from PubChem (CID 7071990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).