C20H27N6O2+ — CID 6963314
3-[(S)-(1-tert-butyltetrazol-5-yl)-morpholin-4-ium-4-ylmethyl]-8-methyl-1H-quinolin-2-one (PubChem CID 6963314) has the molecular formula C20H27N6O2+ and a molecular weight of 383.48 g/mol. Its IUPAC name is 3-[(S)-(1-tert-butyltetrazol-5-yl)-morpholin-4-ium-4-ylmethyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-tert-butyltetrazol-5-yl)-morpholin-4-ium-4-ylmethyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 6963314 |
| Molecular Formula | C20H27N6O2+ |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-[(S)-(1-tert-butyltetrazol-5-yl)-morpholin-4-ium-4-ylmethyl]-8-methyl-1H-quinolin-2-one |
| SMILES | Cc1cccc2cc(C(c3nnnn3C(C)(C)C)[NH+]3CCOCC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C20H26N6O2/c1-13-6-5-7-14-12-15(19(27)21-16(13)14)17(25-8-10-28-11-9-25)18-22-23-24-26(18)20(2,3)4/h5-7,12,17H,8-11H2,1-4H3,(H,21,27)/p+1 |
| InChIKey | FTZSYYUNFBYYIM-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |