C22H29N6O+ — CID 6970469
3-[(S)-(1-cyclohexyltetrazol-5-yl)-pyrrolidin-1-ium-1-ylmethyl]-8-methyl-1H-quinolin-2-one (PubChem CID 6970469) has the molecular formula C22H29N6O+ and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-[(S)-(1-cyclohexyltetrazol-5-yl)-pyrrolidin-1-ium-1-ylmethyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-pyrrolidin-1-ium-1-ylmethyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 6970469 |
| Molecular Formula | C22H29N6O+ |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-pyrrolidin-1-ium-1-ylmethyl]-8-methyl-1H-quinolin-2-one |
| SMILES | Cc1cccc2cc(C(c3nnnn3C3CCCCC3)[NH+]3CCCC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C22H28N6O/c1-15-8-7-9-16-14-18(22(29)23-19(15)16)20(27-12-5-6-13-27)21-24-25-26-28(21)17-10-3-2-4-11-17/h7-9,14,17,20H,2-6,10-13H2,1H3,(H,23,29)/p+1 |
| InChIKey | QQTCQHZPVPLCIN-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |