C27H32N6O — CID 1158320
3-[(S)-[benzyl(ethyl)amino]-(1-cyclohexyltetrazol-5-yl)methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 1158320) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[(S)-[benzyl(ethyl)amino]-(1-cyclohexyltetrazol-5-yl)methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-[benzyl(ethyl)amino]-(1-cyclohexyltetrazol-5-yl)methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1158320 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 3-[(S)-[benzyl(ethyl)amino]-(1-cyclohexyltetrazol-5-yl)methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | CCN(Cc1ccccc1)[C@@H](c1cc2cccc(C)c2[nH]c1=O)c1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C27H32N6O/c1-3-32(18-20-12-6-4-7-13-20)25(26-29-30-31-33(26)22-15-8-5-9-16-22)23-17-21-14-10-11-19(2)24(21)28-27(23)34/h4,6-7,10-14,17,22,25H,3,5,8-9,15-16,18H2,1-2H3,(H,28,34)/t25-/m0/s1 |
| InChIKey | QKIQRPOPILNLFC-VWLOTQADSA-N |
| XLogP | 4.94 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |