C26H30N6O — CID 1146837
3-[(S)-[benzyl(ethyl)amino]-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 1146837) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is 3-[(S)-[benzyl(ethyl)amino]-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-[benzyl(ethyl)amino]-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1146837 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-[(S)-[benzyl(ethyl)amino]-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | CCN(Cc1ccccc1)[C@@H](c1cc2ccc(C)cc2[nH]c1=O)c1nnnn1C1CCCC1 |
| InChI | InChI=1S/C26H30N6O/c1-3-31(17-19-9-5-4-6-10-19)24(25-28-29-30-32(25)21-11-7-8-12-21)22-16-20-14-13-18(2)15-23(20)27-26(22)33/h4-6,9-10,13-16,21,24H,3,7-8,11-12,17H2,1-2H3,(H,27,33)/t24-/m0/s1 |
| InChIKey | XXXFONKVVLABDK-DEOSSOPVSA-N |
| XLogP | 4.55 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |