C18H27ClN6O+2 — CID 7391597
1-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7391597) has the molecular formula C18H27ClN6O+2 and a molecular weight of 378.91 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7391597 |
| Molecular Formula | C18H27ClN6O+2 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@@H](c2ccc(Cl)cc2)c2nnnn2CCOC)CC1 |
| InChI | InChI=1S/C18H25ClN6O/c1-3-8-23-9-11-24(12-10-23)17(15-4-6-16(19)7-5-15)18-20-21-22-25(18)13-14-26-2/h3-7,17H,1,8-14H2,2H3/p+2/t17-/m0/s1 |
| InChIKey | OBBQBUMOCWHQGG-KRWDZBQOSA-P |
| XLogP | -0.97 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|