C20H31FN6+2 — CID 7391347
1-[(R)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7391347) has the molecular formula C20H31FN6+2 and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-[(R)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(R)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7391347 |
| Molecular Formula | C20H31FN6+2 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[(R)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@H](c2ccc(F)cc2)c2nnnn2C(C)(C)CC)CC1 |
| InChI | InChI=1S/C20H29FN6/c1-5-11-25-12-14-26(15-13-25)18(16-7-9-17(21)10-8-16)19-22-23-24-27(19)20(3,4)6-2/h5,7-10,18H,1,6,11-15H2,2-4H3/p+2/t18-/m1/s1 |
| InChIKey | GDFKYLDYPZTFAV-GOSISDBHSA-P |
| XLogP | 0.02 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|