About 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium
1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium (PubChem CID 7436614) has the molecular formula C21H34N5O2+
and a molecular weight of 388.54 g/mol. Its IUPAC name is 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium.
Molecular Properties
| Compound Name | 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium |
| PubChem CID | 7436614 |
| Molecular Formula | C21H34N5O2+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium |
| SMILES | CCC(C)(C)n1nnnc1[C@H](c1ccc(OC)c(OC)c1)[NH+]1CCCCCC1 |
| InChI | InChI=1S/C21H33N5O2/c1-6-21(2,3)26-20(22-23-24-26)19(25-13-9-7-8-10-14-25)16-11-12-17(27-4)18(15-16)28-5/h11-12,15,19H,6-10,13-14H2,1-5H3/p+1/t19-/m0/s1 |
| InChIKey | AFPOJMPPYPABFX-IBGZPJMESA-O |
| XLogP | 2.38 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium?
The IUPAC name of 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium (CID 7436614) is 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium.
What is the SMILES notation for 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium?
The canonical SMILES for 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium is CCC(C)(C)n1nnnc1[C@H](c1ccc(OC)c(OC)c1)[NH+]1CCCCCC1.
What is the InChIKey of 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium?
The InChIKey is AFPOJMPPYPABFX-IBGZPJMESA-O. The full InChI is InChI=1S/C21H33N5O2/c1-6-21(2,3)26-20(22-23-24-26)19(25-13-9-7-8-10-14-25)16-11-12-17(27-4)18(15-16)28-5/h11-12,15,19H,6-10,13-14H2,1-5H3/p+1/t19-/m0/s1.
What are the key properties of 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium?
1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium has a molecular weight of 388.54 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(R)-(3,4-dimethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]azepan-1-ium is sourced from PubChem (CID 7436614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).