C18H28N5OS+ — CID 7205256
4-[(R)-(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]thiomorpholin-4-ium (PubChem CID 7205256) has the molecular formula C18H28N5OS+ and a molecular weight of 362.52 g/mol. Its IUPAC name is 4-[(R)-(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(R)-(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 7205256 |
| Molecular Formula | C18H28N5OS+ |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-[(R)-(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
| SMILES | CCC(C)(C)n1nnnc1[C@@H](c1ccccc1OC)[NH+]1CCSCC1 |
| InChI | InChI=1S/C18H27N5OS/c1-5-18(2,3)23-17(19-20-21-23)16(22-10-12-25-13-11-22)14-8-6-7-9-15(14)24-4/h6-9,16H,5,10-13H2,1-4H3/p+1/t16-/m1/s1 |
| InChIKey | OVNCIVBGQBDHTO-MRXNPFEDSA-O |
| XLogP | 1.55 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |