C19H30N6O — CID 44753204
1-[(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-methylpiperazine (PubChem CID 44753204) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 44753204 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[(2-methoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]-4-methylpiperazine |
| SMILES | CCC(C)(C)n1nnnc1C(c1ccccc1OC)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H30N6O/c1-6-19(2,3)25-18(20-21-22-25)17(24-13-11-23(4)12-14-24)15-9-7-8-10-16(15)26-5/h7-10,17H,6,11-14H2,1-5H3 |
| InChIKey | QTMBEFJSKRUAOY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |