C26H29N6O3+ — CID 6986164
4-[(R)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-(1-benzyltetrazol-5-yl)methyl]morpholin-4-ium (PubChem CID 6986164) has the molecular formula C26H29N6O3+ and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-[(R)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-(1-benzyltetrazol-5-yl)methyl]morpholin-4-ium.
| Compound Name | 4-[(R)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-(1-benzyltetrazol-5-yl)methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 6986164 |
| Molecular Formula | C26H29N6O3+ |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 4-[(R)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-(1-benzyltetrazol-5-yl)methyl]morpholin-4-ium |
| SMILES | Cc1cc([C@H](c2nnnn2Cc2ccccc2)[NH+]2CCOCC2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H28N6O3/c1-18-14-22(19(2)32(18)21-8-9-23-24(15-21)35-17-34-23)25(30-10-12-33-13-11-30)26-27-28-29-31(26)16-20-6-4-3-5-7-20/h3-9,14-15,25H,10-13,16-17H2,1-2H3/p+1/t25-/m1/s1 |
| InChIKey | CGBHIWZGKPBSGH-RUZDIDTESA-O |
| XLogP | 1.86 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|