C17H24N6 — CID 125435857
N-[[(3S)-1-cyclopentylpyrrolidin-3-yl]methyl]-1-phenyltetrazol-5-amine (PubChem CID 125435857) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[[(3S)-1-cyclopentylpyrrolidin-3-yl]methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[[(3S)-1-cyclopentylpyrrolidin-3-yl]methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 125435857 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | N-[[(3S)-1-cyclopentylpyrrolidin-3-yl]methyl]-1-phenyltetrazol-5-amine |
| SMILES | c1ccc(-n2nnnc2NC[C@@H]2CCN(C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C17H24N6/c1-2-8-16(9-3-1)23-17(19-20-21-23)18-12-14-10-11-22(13-14)15-6-4-5-7-15/h1-3,8-9,14-15H,4-7,10-13H2,(H,18,19,21)/t14-/m0/s1 |
| InChIKey | CHXFNJKJVWJRBQ-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |