C18H24N8S — CID 9025927
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-phenyltetrazol-5-amine (PubChem CID 9025927) has the molecular formula C18H24N8S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 9025927 |
| Molecular Formula | C18H24N8S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-phenyltetrazol-5-amine |
| SMILES | CSc1nnc(CCCNc2nnnn2-c2ccccc2)n1C1CCCC1 |
| InChI | InChI=1S/C18H24N8S/c1-27-18-22-20-16(25(18)14-8-5-6-9-14)12-7-13-19-17-21-23-24-26(17)15-10-3-2-4-11-15/h2-4,10-11,14H,5-9,12-13H2,1H3,(H,19,21,24) |
| InChIKey | UOZWEJONSLFGCA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|