C20H32IN7S — CID 111192379
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192379) has the molecular formula C20H32IN7S and a molecular weight of 529.50 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192379 |
| Molecular Formula | C20H32IN7S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1C1CCCC1)NCCc1ccccn1.I |
| InChI | InChI=1S/C20H31N7S.HI/c1-21-19(24-15-12-16-8-5-6-13-22-16)23-14-7-11-18-25-26-20(28-2)27(18)17-9-3-4-10-17;/h5-6,8,13,17H,3-4,7,9-12,14-15H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | ARTAKHZHENUZQJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|