C22H35IN6O2S — CID 111879300
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111879300) has the molecular formula C22H35IN6O2S and a molecular weight of 574.53 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111879300 |
| Molecular Formula | C22H35IN6O2S |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1C1CCCC1)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C22H34N6O2S.HI/c1-23-21(25-15-16-11-12-18(29-2)14-19(16)30-3)24-13-7-10-20-26-27-22(31-4)28(20)17-8-5-6-9-17;/h11-12,14,17H,5-10,13,15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | NCZOYBYTQSHDQM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|