C21H41IN6OS — CID 111717237
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine;hydroiodide (PubChem CID 111717237) has the molecular formula C21H41IN6OS and a molecular weight of 552.57 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111717237 |
| Molecular Formula | C21H41IN6OS |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOC(CCN/C(=N\C)NCCCc1nnc(SC)n1C1CCCC1)C(C)C.I |
| InChI | InChI=1S/C21H40N6OS.HI/c1-6-28-18(16(2)3)13-15-24-20(22-4)23-14-9-12-19-25-26-21(29-5)27(19)17-10-7-8-11-17;/h16-18H,6-15H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | KGSKKVXFCMIBBB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|