C22H39N7OS — CID 111569973
1-[[[N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569973) has the molecular formula C22H39N7OS and a molecular weight of 449.67 g/mol. Its IUPAC name is 1-[[[N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569973 |
| Molecular Formula | C22H39N7OS |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 1-[[[N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCCCc1nnc(SC)n1C1CCCC1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C22H39N7OS/c1-23-20(25-16-22(13-7-8-14-22)19(30)28(2)3)24-15-9-12-18-26-27-21(31-4)29(18)17-10-5-6-11-17/h17H,5-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | NSVGHXMQYCGOQL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|