C19H30N6S2 — CID 111348854
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111348854) has the molecular formula C19H30N6S2 and a molecular weight of 406.63 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111348854 |
| Molecular Formula | C19H30N6S2 |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCCc1nnc(SC)n1C1CCCC1)NCCc1cccs1 |
| InChI | InChI=1S/C19H30N6S2/c1-20-18(22-13-11-16-9-6-14-27-16)21-12-5-10-17-23-24-19(26-2)25(17)15-7-3-4-8-15/h6,9,14-15H,3-5,7-8,10-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | POPWRFHVHYBOTM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|