C21H39IN6O2S — CID 111645697
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111645697) has the molecular formula C21H39IN6O2S and a molecular weight of 566.55 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111645697 |
| Molecular Formula | C21H39IN6O2S |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCCCc1nnc(SC)n1C1CCCC1.I |
| InChI | InChI=1S/C21H38N6O2S.HI/c1-22-20(24-12-6-13-28-15-17-10-14-29-16-17)23-11-5-9-19-25-26-21(30-2)27(19)18-7-3-4-8-18;/h17-18H,3-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | AUHCWHBTSZNEFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|