C22H42N6OS — CID 111718402
2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine (PubChem CID 111718402) has the molecular formula C22H42N6OS and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine.
| Compound Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111718402 |
| Molecular Formula | C22H42N6OS |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1C1CCCC1)NCCC(OCC)C(C)C |
| InChI | InChI=1S/C22H42N6OS/c1-6-23-21(25-16-14-19(17(3)4)29-7-2)24-15-10-13-20-26-27-22(30-5)28(20)18-11-8-9-12-18/h17-19H,6-16H2,1-5H3,(H2,23,24,25) |
| InChIKey | FJXHUMLXCRLJLP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|