C23H36N6OS — CID 111418415
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(3-phenoxypropyl)guanidine (PubChem CID 111418415) has the molecular formula C23H36N6OS and a molecular weight of 444.65 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(3-phenoxypropyl)guanidine.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(3-phenoxypropyl)guanidine |
|---|---|
| PubChem CID | 111418415 |
| Molecular Formula | C23H36N6OS |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(3-phenoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOc1ccccc1)NCCCc1nnc(SC)n1C1CCCC1 |
| InChI | InChI=1S/C23H36N6OS/c1-3-24-22(26-17-10-18-30-20-13-5-4-6-14-20)25-16-9-15-21-27-28-23(31-2)29(21)19-11-7-8-12-19/h4-6,13-14,19H,3,7-12,15-18H2,1-2H3,(H2,24,25,26) |
| InChIKey | FYEKGPWJUZGUKK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|