C23H37IN6OS — CID 111273138
2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methyl-1-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111273138) has the molecular formula C23H37IN6OS and a molecular weight of 572.56 g/mol. Its IUPAC name is 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methyl-1-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111273138 |
| Molecular Formula | C23H37IN6OS |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1C1CCCC1)N(C)CCOc1ccccc1.I |
| InChI | InChI=1S/C23H36N6OS.HI/c1-4-24-22(28(2)17-18-30-20-13-6-5-7-14-20)25-16-10-15-21-26-27-23(31-3)29(21)19-11-8-9-12-19;/h5-7,13-14,19H,4,8-12,15-18H2,1-3H3,(H,24,25);1H |
| InChIKey | MEXHDNBUASYKNA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|