C22H35IN6OS — CID 111273600
3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111273600) has the molecular formula C22H35IN6OS and a molecular weight of 558.53 g/mol. Its IUPAC name is 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111273600 |
| Molecular Formula | C22H35IN6OS |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1C1CCCC1)N(C)CCOc1ccccc1.I |
| InChI | InChI=1S/C22H34N6OS.HI/c1-23-21(27(2)16-17-29-19-12-5-4-6-13-19)24-15-9-14-20-25-26-22(30-3)28(20)18-10-7-8-11-18;/h4-6,12-13,18H,7-11,14-17H2,1-3H3,(H,23,24);1H |
| InChIKey | FOYHMOWARZKVQK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|