C21H40N6OS — CID 111712995
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine (PubChem CID 111712995) has the molecular formula C21H40N6OS and a molecular weight of 424.66 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine |
|---|---|
| PubChem CID | 111712995 |
| Molecular Formula | C21H40N6OS |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCCc1nnc(SC)n1C1CCCC1 |
| InChI | InChI=1S/C21H40N6OS/c1-4-9-17(13-15-28)16-24-20(22-5-2)23-14-8-12-19-25-26-21(29-3)27(19)18-10-6-7-11-18/h17-18,28H,4-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | NJOJZFWQMFEZAY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|