C17H22ClN5O2S — CID 9025932
2-chloro-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-nitroaniline (PubChem CID 9025932) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-nitroaniline.
| Compound Name | 2-chloro-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-nitroaniline |
|---|---|
| PubChem CID | 9025932 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-chloro-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-nitroaniline |
| SMILES | CSc1nnc(CCCNc2ccc([N+](=O)[O-])cc2Cl)n1C1CCCC1 |
| InChI | InChI=1S/C17H22ClN5O2S/c1-26-17-21-20-16(22(17)12-5-2-3-6-12)7-4-10-19-15-9-8-13(23(24)25)11-14(15)18/h8-9,11-12,19H,2-7,10H2,1H3 |
| InChIKey | UECGWMGXYFXFKF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|