C15H19ClN4O3 — CID 47080468
2-chloro-N-[3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]propyl]-4-nitroaniline (PubChem CID 47080468) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]propyl]-4-nitroaniline.
| Compound Name | 2-chloro-N-[3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]propyl]-4-nitroaniline |
|---|---|
| PubChem CID | 47080468 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-chloro-N-[3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]propyl]-4-nitroaniline |
| SMILES | CC(C)Cc1noc(CCCNc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C15H19ClN4O3/c1-10(2)8-14-18-15(23-19-14)4-3-7-17-13-6-5-11(20(21)22)9-12(13)16/h5-6,9-10,17H,3-4,7-8H2,1-2H3 |
| InChIKey | ULHLCZTUYHIEJI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|