C16H18ClN3O4S — CID 561067
N-[3-(2-chloro-4-nitroanilino)propyl]-1-phenylmethanesulfonamide (PubChem CID 561067) has the molecular formula C16H18ClN3O4S and a molecular weight of 383.86 g/mol. Its IUPAC name is N-[3-(2-chloro-4-nitroanilino)propyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[3-(2-chloro-4-nitroanilino)propyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 561067 |
| Molecular Formula | C16H18ClN3O4S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[3-(2-chloro-4-nitroanilino)propyl]-1-phenylmethanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NCCCNS(=O)(=O)Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O4S/c17-15-11-14(20(21)22)7-8-16(15)18-9-4-10-19-25(23,24)12-13-5-2-1-3-6-13/h1-3,5-8,11,18-19H,4,9-10,12H2 |
| InChIKey | DLIFQSYLCQFWJH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|