C18H23N7O2S — CID 55431762
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 55431762) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-nitroimidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 55431762 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | CSc1nnc(CCCNc2nc3ccccn3c2[N+](=O)[O-])n1C1CCCC1 |
| InChI | InChI=1S/C18H23N7O2S/c1-28-18-22-21-15(24(18)13-7-2-3-8-13)10-6-11-19-16-17(25(26)27)23-12-5-4-9-14(23)20-16/h4-5,9,12-13,19H,2-3,6-8,10-11H2,1H3 |
| InChIKey | FFCLCSDFTCQPCI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|