C17H26N6 — CID 17418964
N-[[1-(dimethylamino)cycloheptyl]methyl]-1-phenyltetrazol-5-amine (PubChem CID 17418964) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cycloheptyl]methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 17418964 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-1-phenyltetrazol-5-amine |
| SMILES | CN(C)C1(CNc2nnnn2-c2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C17H26N6/c1-22(2)17(12-8-3-4-9-13-17)14-18-16-19-20-21-23(16)15-10-6-5-7-11-15/h5-7,10-11H,3-4,8-9,12-14H2,1-2H3,(H,18,19,21) |
| InChIKey | OQVGXWBAMKVYTM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |