C11H13N5 — CID 63207972
5-methyl-N-[(2-methylpyrimidin-4-yl)methyl]pyrimidin-2-amine (PubChem CID 63207972) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-methyl-N-[(2-methylpyrimidin-4-yl)methyl]pyrimidin-2-amine.
| Compound Name | 5-methyl-N-[(2-methylpyrimidin-4-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 63207972 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 5-methyl-N-[(2-methylpyrimidin-4-yl)methyl]pyrimidin-2-amine |
| SMILES | Cc1cnc(NCc2ccnc(C)n2)nc1 |
| InChI | InChI=1S/C11H13N5/c1-8-5-13-11(14-6-8)15-7-10-3-4-12-9(2)16-10/h3-6H,7H2,1-2H3,(H,13,14,15) |
| InChIKey | PUFRKBQYDMXIKN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |