C12H9F4N3 — CID 107644035
2,3,5,6-tetrafluoro-N-[(2-methylpyrimidin-4-yl)methyl]aniline (PubChem CID 107644035) has the molecular formula C12H9F4N3 and a molecular weight of 271.22 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(2-methylpyrimidin-4-yl)methyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(2-methylpyrimidin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 107644035 |
| Molecular Formula | C12H9F4N3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(2-methylpyrimidin-4-yl)methyl]aniline |
| SMILES | Cc1nccc(CNc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C12H9F4N3/c1-6-17-3-2-7(19-6)5-18-12-10(15)8(13)4-9(14)11(12)16/h2-4,18H,5H2,1H3 |
| InChIKey | OKTUZNNZNINJFU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|