C16H16ClN7O — CID 78896470
1-(3-chlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea (PubChem CID 78896470) has the molecular formula C16H16ClN7O and a molecular weight of 357.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 78896470 |
| Molecular Formula | C16H16ClN7O |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea |
| SMILES | O=C(NCCNc1nnnn1-c1ccccc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN7O/c17-12-5-4-6-13(11-12)20-16(25)19-10-9-18-15-21-22-23-24(15)14-7-2-1-3-8-14/h1-8,11H,9-10H2,(H,18,21,23)(H2,19,20,25) |
| InChIKey | XKAZCNVFQRFTMM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|